Products 2736-23-4
CAS 2736-23-4 appears in our catalog under these names: 2,4-Dichloro-5-sulfamoylbenzoic acid, 98%, Furosemide EP Impurity B, 2,4-Dichloro-5-sulfamoylbenzoic Acid, >95% (HPLC), 2,4-Dichloro-5-sulphamoylbenzoic Acid, M 12325. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, TargetMol. Available pack sizes: 5g, 100g, 500g, 1kg, 25g, on request, 10g, 1g.
2,4-dichloro-5-sulfamoylbenzoic acid (CAS 2736-23-4) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: 2,4-dichloro-5-sulfamoylbenzoic acid. InChIKey: ZSHHRBYVHTVRFK-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO4S |
|---|---|
| Molecular weight | 270.09 g/mol |
| IUPAC name | 2,4-dichloro-5-sulfamoylbenzoic acid |
| InChIKey | ZSHHRBYVHTVRFK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)N)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Dichloro-5-sulfamoylbenzoic acid, 5-(Aminosulfonyl)-2,4-dichlorobenzoic acid, Benzoic acid, 5-(aminosulfonyl)-2,4-dichloro-, 3-Sulfamoyl-4,6-dichlorobenzoic acid, 5-Carboxy-2,4-dichlorobenzenesulfonamide, 5-Aminosulfonyl-2,4-dichlorobenzoic acid, Lasamide, 2,4-Dichloro-5-sulfamoyl-benzoic acid, Furosemide EP impurity B, 2,4-Dichloro-5-sulphamoylbenzoic acid