Products 78726-74-6
CAS 78726-74-6 is the registry number for 3-Chloro-4-methyl-5-nitrobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-chloro-4-methyl-5-nitrobenzenesulfonyl chloride (CAS 78726-74-6) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: 3-chloro-4-methyl-5-nitrobenzenesulfonyl chloride. InChIKey: XMJPTCBXPMZLLJ-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO4S |
|---|---|
| Molecular weight | 270.09 g/mol |
| IUPAC name | 3-chloro-4-methyl-5-nitrobenzenesulfonyl chloride |
| InChIKey | XMJPTCBXPMZLLJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)