Products 1250693-09-4
CAS 1250693-09-4 appears in our catalog under these names: (2-Chloro-5-nitrophenyl)methanesulfonyl chloride, 95%, (2-Chloro-5-nitrophenyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(2-chloro-5-nitrophenyl)methanesulfonyl chloride (CAS 1250693-09-4) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: (2-chloro-5-nitrophenyl)methanesulfonyl chloride. InChIKey: UZOYWZKZKRKZEU-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO4S |
|---|---|
| Molecular weight | 270.09 g/mol |
| IUPAC name | (2-chloro-5-nitrophenyl)methanesulfonyl chloride |
| InChIKey | UZOYWZKZKRKZEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CS(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)