Products 98273-22-4

CAS 98273-22-4 appears in our catalog under these names: 4-Chloro-2-methyl-5-nitrobenzene-1-sulfonyl chloride, 95+%, 4-Chloro-2-methyl-5-nitrobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

4-chloro-2-methyl-5-nitrobenzenesulfonyl chloride (CAS 98273-22-4) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: 4-chloro-2-methyl-5-nitrobenzenesulfonyl chloride. InChIKey: BABZCNCBFPIBSP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2NO4S
Molecular weight270.09 g/mol
IUPAC name4-chloro-2-methyl-5-nitrobenzenesulfonyl chloride
InChIKeyBABZCNCBFPIBSP-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1S(=O)(=O)Cl)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)