Products 871876-54-9

CAS 871876-54-9 appears in our catalog under these names: 2-Chloro-5-methyl-3-nitrobenzene-1-sulfonyl chloride, 95%, 2-Chloro-5-methyl-3-nitrobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

2-chloro-5-methyl-3-nitrobenzenesulfonyl chloride (CAS 871876-54-9) is a chemical compound with the molecular formula C7H5Cl2NO4S and a molecular weight of 270.09 g/mol. IUPAC name: 2-chloro-5-methyl-3-nitrobenzenesulfonyl chloride. InChIKey: VSCYJOGSJGGTSD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2NO4S
Molecular weight270.09 g/mol
IUPAC name2-chloro-5-methyl-3-nitrobenzenesulfonyl chloride
InChIKeyVSCYJOGSJGGTSD-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)S(=O)(=O)Cl)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)