3-Chloro-2,6-difluorobenzoic acid, 97%
cas: 225104-76-7 — see every product listed under this CAS number, including other names
3-Chloro-2,6-difluorobenzoic acid, 97% (CAS 225104-76-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A426742-250mg |
| cas | 225104-76-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 520.56 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 197.73 Pln | |
| BLDpharm | 25g | 553.16 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 529.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-chloro-2,6-difluorobenzoic acid (CAS 225104-76-7) is a chemical compound with the molecular formula C7H3ClF2O2 and a molecular weight of 192.55 g/mol. IUPAC name: 3-chloro-2,6-difluorobenzoic acid. InChIKey: APQTVWJSXBBNEI-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2O2 |
|---|---|
| Molecular weight | 192.55 g/mol |
| IUPAC name | 3-chloro-2,6-difluorobenzoic acid |
| InChIKey | APQTVWJSXBBNEI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)F)Cl |
Computed by PubChem (NCBI)