cas: 886496-83-9 — see every product listed under this CAS number, including other names
3-Chloro-5-(trifluoromethyl)benzoyl chloride, ≥95%, ≥95% (CAS 886496-83-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GY4G-1g |
| cas | 886496-83-9 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 3722.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3-chloro-5-(trifluoromethyl)benzoyl chloride (CAS 886496-83-9) is a chemical compound with the molecular formula C8H3Cl2F3O and a molecular weight of 243.01 g/mol. IUPAC name: 3-chloro-5-(trifluoromethyl)benzoyl chloride. InChIKey: CPGKYJRZLOSIDS-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F3O |
|---|---|
| Molecular weight | 243.01 g/mol |
| IUPAC name | 3-chloro-5-(trifluoromethyl)benzoyl chloride |
| InChIKey | CPGKYJRZLOSIDS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)Cl)C(=O)Cl |
Computed by PubChem (NCBI)