cas: 92495-54-0 — see every product listed under this CAS number, including other names
4'-METHOXY-2-METHYL-1,1'-BIPHENYL, 95% (CAS 92495-54-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F854520-100MG |
| cas | 92495-54-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 841.39 Pln | |
| Fluorochem | 1g | 1627.57 Pln | |
| Fluorochem | 5g | 5683.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-methoxy-4-(2-methylphenyl)benzene (CAS 92495-54-0) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 1-methoxy-4-(2-methylphenyl)benzene. InChIKey: GNYJFZNIMOMCCF-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 1-methoxy-4-(2-methylphenyl)benzene |
| InChIKey | GNYJFZNIMOMCCF-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)