cas: 92495-54-0 — see every product listed under this CAS number, including other names
4'-Methoxy-2-methyl-1,1'-biphenyl, 95%, 95% (CAS 92495-54-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117HR8-100mg |
| cas | 92495-54-0 |
| size | 100mg |
| availability | 8.02g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1240.40 Pln | |
| Chemat | 5g | 4288.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-methoxy-4-(2-methylphenyl)benzene (CAS 92495-54-0) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 1-methoxy-4-(2-methylphenyl)benzene. InChIKey: GNYJFZNIMOMCCF-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 1-methoxy-4-(2-methylphenyl)benzene |
| InChIKey | GNYJFZNIMOMCCF-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)