cas: 171178-48-6 — see every product listed under this CAS number, including other names
4,6-Dichloropyrido(3,4-d)pyrimidine, 97% (CAS 171178-48-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A444517-1g |
| cas | 171178-48-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 9971.71 Pln | |
| AmBeed | 5g | 22138.90 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,6-dichloropyrido[3,4-d]pyrimidine (CAS 171178-48-6) is a chemical compound with the molecular formula C7H3Cl2N3 and a molecular weight of 200.02 g/mol. IUPAC name: 4,6-dichloropyrido[3,4-d]pyrimidine. InChIKey: CKPNVNAKQGYUSK-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N3 |
|---|---|
| Molecular weight | 200.02 g/mol |
| IUPAC name | 4,6-dichloropyrido[3,4-d]pyrimidine |
| InChIKey | CKPNVNAKQGYUSK-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1Cl)N=CN=C2Cl |
Computed by PubChem (NCBI)