4,7-Dibromoquinoline, 96%
cas: 700871-88-1 — see every product listed under this CAS number, including other names
4,7-Dibromoquinoline, 96% (CAS 700871-88-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239096-100MG |
| cas | 700871-88-1 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 5g | 1794.18 Pln | |
| Fluorochem | 10g | 3538.36 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
4,7-dibromoquinoline (CAS 700871-88-1) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 4,7-dibromoquinoline. InChIKey: FARNFRFWNKSWAN-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 4,7-dibromoquinoline |
| InChIKey | FARNFRFWNKSWAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1Br)Br |
Computed by PubChem (NCBI)