cas: 700871-88-1 — see every product listed under this CAS number, including other names
4,7-Dibromoquinoline, 97%, 97% (CAS 700871-88-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FBDS-100mg |
| cas | 700871-88-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 1062.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4,7-dibromoquinoline (CAS 700871-88-1) is a chemical compound with the molecular formula C9H5Br2N and a molecular weight of 286.95 g/mol. IUPAC name: 4,7-dibromoquinoline. InChIKey: FARNFRFWNKSWAN-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2N |
|---|---|
| Molecular weight | 286.95 g/mol |
| IUPAC name | 4,7-dibromoquinoline |
| InChIKey | FARNFRFWNKSWAN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C=C1Br)Br |
Computed by PubChem (NCBI)