cas: 2148-55-2 — see every product listed under this CAS number, including other names
4,5-Dichloroquinazoline, >95%, >95% (CAS 2148-55-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144V7-100mg |
| cas | 2148-55-2 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 741.20 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
4,5-dichloroquinazoline (CAS 2148-55-2) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 4,5-dichloroquinazoline. InChIKey: PCCZEWAQRDIOKD-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 4,5-dichloroquinazoline |
| InChIKey | PCCZEWAQRDIOKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=NC=N2)Cl |
Computed by PubChem (NCBI)