cas: 156635-87-9 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-2,3-difluorophenylboronic acid, 97%, 97% (CAS 156635-87-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OVC-250mg |
| cas | 156635-87-9 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 198.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,3-difluoro-4-phenylmethoxyphenyl)boronic acid (CAS 156635-87-9) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,3-difluoro-4-phenylmethoxyphenyl)boronic acid. InChIKey: SWMFGSPOFIKKMJ-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,3-difluoro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | SWMFGSPOFIKKMJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC2=CC=CC=C2)F)F)(O)O |
Computed by PubChem (NCBI)