cas: 156635-87-9 — see every product listed under this CAS number, including other names
4-Benzyloxy-2,3-difluorophenylboronic acid, 97% (CAS 156635-87-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218935-10G |
| cas | 156635-87-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 1060.06 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 560.24 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2,3-difluoro-4-phenylmethoxyphenyl)boronic acid (CAS 156635-87-9) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,3-difluoro-4-phenylmethoxyphenyl)boronic acid. InChIKey: SWMFGSPOFIKKMJ-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,3-difluoro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | SWMFGSPOFIKKMJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OCC2=CC=CC=C2)F)F)(O)O |
Computed by PubChem (NCBI)