cas: 16331-48-9 — see every product listed under this CAS number, including other names
4-ACETAMIDOBENZOYL CHLORIDE, 95% (CAS 16331-48-9) is a chemical reagent available from Chemat. Available pack sizes: 200mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F532532-200MG |
| cas | 16331-48-9 |
| size | 200mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 200mg | 331.15 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-acetamidobenzoyl chloride (CAS 16331-48-9) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 4-acetamidobenzoyl chloride. InChIKey: KRKXGCJUNKZXOY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 4-acetamidobenzoyl chloride |
| InChIKey | KRKXGCJUNKZXOY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)