CAS 90537-30-7 appears in our catalog under these names: 3-Chloro-4,5-dimethoxybenzonitrile, 95%, 3-Chloro-4,5-dimethoxybenzonitrile, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-chloro-4,5-dimethoxybenzonitrile (CAS 90537-30-7) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 3-chloro-4,5-dimethoxybenzonitrile. InChIKey: FYVNQNKFUPQFLQ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 3-chloro-4,5-dimethoxybenzonitrile |
| InChIKey | FYVNQNKFUPQFLQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C#N)Cl)OC |
Computed by PubChem (NCBI)