cas: 116-63-2 — see every product listed under this CAS number, including other names
4-Amino-3-hydroxynaphthalene-1-sulfonic acid ≥90% (CAS 116-63-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1453894-25g |
| cas | 116-63-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 398.19 Pln | |
| Ambeed | 500g | 1093.50 Pln |
| purity | ≥90% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1453894 |
4-amino-3-hydroxynaphthalene-1-sulfonic acid is a naphthalenesulfonic acid and an aminonaphthalene. It has a role as a mutagen. It is functionally related to a 2-naphthol.
Source: ChEBI
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 4-amino-3-hydroxynaphthalene-1-sulfonic acid |
| InChIKey | RXCMFQDTWCCLBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2N)O)S(=O)(=O)O |
Computed by PubChem (NCBI)