cas: 116-63-2 — see every product listed under this CAS number, including other names
4-Amino-3-hydroxynaphthalene-1-sulfonic acid, 95%, 95% (CAS 116-63-2) is a chemical reagent available from Chemat. Available pack sizes: 5kg, 10kg, 25kg, 5g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111BCI-5kg |
| cas | 116-63-2 |
| size | 5kg |
| availability | 25000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5kg | 2827.20 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 184.40 Pln | |
| Chemat | 250g | 333.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-amino-3-hydroxynaphthalene-1-sulfonic acid is a naphthalenesulfonic acid and an aminonaphthalene. It has a role as a mutagen. It is functionally related to a 2-naphthol.
Source: ChEBI
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 4-amino-3-hydroxynaphthalene-1-sulfonic acid |
| InChIKey | RXCMFQDTWCCLBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2N)O)S(=O)(=O)O |
Computed by PubChem (NCBI)