Products 1784119-83-0

CAS 1784119-83-0 is the registry number for Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate (CAS 1784119-83-0) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: ethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate. InChIKey: PRGLYIIBPLLZLF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO4S
Molecular weight239.25 g/mol
IUPAC nameethyl 7-cyano-2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carboxylate
InChIKeyPRGLYIIBPLLZLF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C2C(=C(S1)C#N)OCCO2

Computed by PubChem (NCBI)