cas: 72256-93-0 — see every product listed under this CAS number, including other names
4-Bromo-3-methylbenzenesulfonyl chloride (CAS 72256-93-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013070-1G |
| cas | 72256-93-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 25g | 1471.37 Pln |
| delivery time | 2-3 weeks |
|---|
4-bromo-3-methylbenzenesulfonyl chloride (CAS 72256-93-0) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 4-bromo-3-methylbenzenesulfonyl chloride. InChIKey: JRNDXUKMWFVEIC-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 4-bromo-3-methylbenzenesulfonyl chloride |
| InChIKey | JRNDXUKMWFVEIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)