cas: 66176-39-4 — see every product listed under this CAS number, including other names
4-Bromomethylbenzenesulfonyl chloride, 95% (CAS 66176-39-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 360540010 |
| cas | 66176-39-4 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 115.37 Pln | |
| Thermo Scientific (Acros) | 5g | 371.95 Pln | |
| Thermo Scientific (Acros) | 25g | 1149.25 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
4-(bromomethyl)benzenesulfonyl chloride (CAS 66176-39-4) is a chemical compound with the molecular formula C7H6BrClO2S and a molecular weight of 269.54 g/mol. IUPAC name: 4-(bromomethyl)benzenesulfonyl chloride. InChIKey: QXTQWYZHHMQSQH-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO2S |
|---|---|
| Molecular weight | 269.54 g/mol |
| IUPAC name | 4-(bromomethyl)benzenesulfonyl chloride |
| InChIKey | QXTQWYZHHMQSQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)S(=O)(=O)Cl |
Computed by PubChem (NCBI)