CAS 2055778-26-0 appears in our catalog under these names: 4-Chloro-2,5-difluorophenylboronic acid, 95%, 4-Chloro-2,5-difluorophenylboronic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
(4-chloro-2,5-difluorophenyl)boronic acid (CAS 2055778-26-0) is a chemical compound with the molecular formula C6H4BClF2O2 and a molecular weight of 192.36 g/mol. IUPAC name: (4-chloro-2,5-difluorophenyl)boronic acid. InChIKey: LRZWCWTWFFVBGT-UHFFFAOYSA-N.
| Molecular formula | C6H4BClF2O2 |
|---|---|
| Molecular weight | 192.36 g/mol |
| IUPAC name | (4-chloro-2,5-difluorophenyl)boronic acid |
| InChIKey | LRZWCWTWFFVBGT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)Cl)F)(O)O |
Computed by PubChem (NCBI)