cas: 1132-17-8 — see every product listed under this CAS number, including other names
4-Ethoxybenzene-1-sulfonyl chloride 98% (CAS 1132-17-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A387521-250mg |
| cas | 1132-17-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 464.94 Pln | |
| Ambeed | 10g | 848.75 Pln | |
| Ambeed | 25g | 1354.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A387521 |
4-ethoxybenzenesulfonyl chloride (CAS 1132-17-8) is a chemical compound with the molecular formula C8H9ClO3S and a molecular weight of 220.67 g/mol. IUPAC name: 4-ethoxybenzenesulfonyl chloride. InChIKey: XIWSSFMVSKKXRJ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3S |
|---|---|
| Molecular weight | 220.67 g/mol |
| IUPAC name | 4-ethoxybenzenesulfonyl chloride |
| InChIKey | XIWSSFMVSKKXRJ-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)