5,6-Dibromonicotinic acid 98%
cas: 29241-64-3 — see every product listed under this CAS number, including other names
5,6-Dibromonicotinic acid 98% (CAS 29241-64-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A183701-1g |
| cas | 29241-64-3 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 25g | 921.06 Pln | |
| Ambeed | 100g | 3418.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A183701 |
5,6-dibromopyridine-3-carboxylic acid (CAS 29241-64-3) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 5,6-dibromopyridine-3-carboxylic acid. InChIKey: ABBCIGFWDCOGEQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 5,6-dibromopyridine-3-carboxylic acid |
| InChIKey | ABBCIGFWDCOGEQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)