cas: 29241-64-3 — see every product listed under this CAS number, including other names
5,6-Dibromonicotinic acid, 98%, 98% (CAS 29241-64-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113XT9-250mg |
| cas | 29241-64-3 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 10g | 290.00 Pln | |
| Chemat | 25g | 534.80 Pln | |
| Chemat | 50g | 1000.40 Pln | |
| Chemat | 100g | 1850.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,6-dibromopyridine-3-carboxylic acid (CAS 29241-64-3) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 5,6-dibromopyridine-3-carboxylic acid. InChIKey: ABBCIGFWDCOGEQ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 5,6-dibromopyridine-3-carboxylic acid |
| InChIKey | ABBCIGFWDCOGEQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)