cas: 953752-64-2 — see every product listed under this CAS number, including other names
5-(2,5-Dimethoxyphenyl)isoxazole-3-carboxylic acid, 97% (CAS 953752-64-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A863723-10g |
| cas | 953752-64-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19365.64 Pln | |
| AmBeed | 5g | 12341.35 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid (CAS 953752-64-2) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: SHKJDWPURNWNTI-UHFFFAOYSA-N.
| Molecular formula | C12H11NO5 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 5-(2,5-dimethoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | SHKJDWPURNWNTI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)