Products 1255147-76-2

CAS 1255147-76-2 is the registry number for 1-(2-Carboxyphenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

1-(2-carboxyphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 1255147-76-2) is a chemical compound with the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. IUPAC name: 1-(2-carboxyphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: ONLLTVWUGWKXGX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11NO5
Molecular weight249.22 g/mol
IUPAC name1-(2-carboxyphenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyONLLTVWUGWKXGX-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=CC=CC=C2C(=O)O)C(=O)O

Computed by PubChem (NCBI)