cas: 2404734-15-0 — see every product listed under this CAS number, including other names
5-Bromo-2,4-difluoro-3-methylbenzoic acid, 98% (CAS 2404734-15-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1634827-25g |
| cas | 2404734-15-0 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 19873.42 Pln | |
| AmBeed | 10g | 10140.97 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromo-2,4-difluoro-3-methylbenzoic acid (CAS 2404734-15-0) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: 5-bromo-2,4-difluoro-3-methylbenzoic acid. InChIKey: KMVMOIZGQOWOHS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 5-bromo-2,4-difluoro-3-methylbenzoic acid |
| InChIKey | KMVMOIZGQOWOHS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1F)Br)C(=O)O)F |
Computed by PubChem (NCBI)