5-Bromo-2-fluoro-3-nitrobenzoic acid, 95%
cas: 1153279-80-1 — see every product listed under this CAS number, including other names
5-Bromo-2-fluoro-3-nitrobenzoic acid, 95% (CAS 1153279-80-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603130-250MG |
| cas | 1153279-80-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 10g | 325.94 Pln | |
| Fluorochem | 25g | 549.82 Pln | |
| Fluorochem | 100g | 1794.18 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-fluoro-3-nitrobenzoic acid (CAS 1153279-80-1) is a chemical compound with the molecular formula C7H3BrFNO4 and a molecular weight of 264.00 g/mol. IUPAC name: 5-bromo-2-fluoro-3-nitrobenzoic acid. InChIKey: SXOKSXISBYNNQM-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFNO4 |
|---|---|
| Molecular weight | 264.00 g/mol |
| IUPAC name | 5-bromo-2-fluoro-3-nitrobenzoic acid |
| InChIKey | SXOKSXISBYNNQM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)