5-Carboxy-2-ethoxyphenylboronic acid 97%
cas: 1451391-73-3 — see every product listed under this CAS number, including other names
5-Carboxy-2-ethoxyphenylboronic acid 97% (CAS 1451391-73-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A918541-100mg |
| cas | 1451391-73-3 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 832.06 Pln | |
| Ambeed | 5g | 2790.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A918541 |
3-borono-4-ethoxybenzoic acid (CAS 1451391-73-3) is a chemical compound with the molecular formula C9H11BO5 and a molecular weight of 209.99 g/mol. IUPAC name: 3-borono-4-ethoxybenzoic acid. InChIKey: CMUVOHRXIPPHFW-UHFFFAOYSA-N.
| Molecular formula | C9H11BO5 |
|---|---|
| Molecular weight | 209.99 g/mol |
| IUPAC name | 3-borono-4-ethoxybenzoic acid |
| InChIKey | CMUVOHRXIPPHFW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)O)OCC)(O)O |
Computed by PubChem (NCBI)