5-Nitro-2,3-dihydrophthalazine-1,4-dione, 98%, 98%
cas: 3682-15-3 — see every product listed under this CAS number, including other names
5-Nitro-2,3-dihydrophthalazine-1,4-dione, 98%, 98% (CAS 3682-15-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 15g, 25g, 50g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114JTR-1g |
| cas | 3682-15-3 |
| size | 1g |
| availability | 3000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 15g | 170.00 Pln | |
| Chemat | 25g | 208.40 Pln | |
| Chemat | 50g | 347.60 Pln | |
| Chemat | 100g | 549.20 Pln | |
| Chemat | 500g | 1843.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-nitro-2,3-dihydrophthalazine-1,4-dione (CAS 3682-15-3) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 5-nitro-2,3-dihydrophthalazine-1,4-dione. InChIKey: YVOBBFQJMOGQOU-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 5-nitro-2,3-dihydrophthalazine-1,4-dione |
| InChIKey | YVOBBFQJMOGQOU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)NNC2=O |
Computed by PubChem (NCBI)
Synonyms:
5-nitro-2,3-dihydrophthalazine-1,4-dione, 1,4-Phthalazinedione, 2,3-dihydro-5-nitro-, 3-Nitro-phthalhydrazide, YVOBBFQJMOGQOU-UHFFFAOYSA-, 3-Nitrophthalhydrazide, 3-Nitrophthalic Hydrazide, 2,3-Dihydro-5-nitro-1,4-phthalazinedione, 5-nitrophthalhydrazide, 3-Nitrophthalic hydrazine, Oprea1_294149