5-Nitro-2,3-dihydrophthalazine-1,4-dione, 98%
cas: 3682-15-3 — see every product listed under this CAS number, including other names
5-Nitro-2,3-dihydrophthalazine-1,4-dione, 98% (CAS 3682-15-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114JTR-1g |
| cas | 3682-15-3 |
| size | 1g |
| availability | 7500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 232.40 Pln | |
| Chemat | 100g | 698.00 Pln | |
| Chemat | 500g | 2174.40 Pln | |
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 100g | 1289.15 Pln | |
| Fluorochem | 500g | 3892.40 Pln | |
| Fluorochem | 10g | 206.20 Pln | |
| Fluorochem | 25g | 404.04 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-nitro-2,3-dihydrophthalazine-1,4-dione (CAS 3682-15-3) is a chemical compound with the molecular formula C8H5N3O4 and a molecular weight of 207.14 g/mol. IUPAC name: 5-nitro-2,3-dihydrophthalazine-1,4-dione. InChIKey: YVOBBFQJMOGQOU-UHFFFAOYSA-N.
| Molecular formula | C8H5N3O4 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 5-nitro-2,3-dihydrophthalazine-1,4-dione |
| InChIKey | YVOBBFQJMOGQOU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)NNC2=O |
Computed by PubChem (NCBI)
Synonyms:
5-nitro-2,3-dihydrophthalazine-1,4-dione, 1,4-Phthalazinedione, 2,3-dihydro-5-nitro-, 3-Nitro-phthalhydrazide, YVOBBFQJMOGQOU-UHFFFAOYSA-, 3-Nitrophthalhydrazide, 3-Nitrophthalic Hydrazide, 2,3-Dihydro-5-nitro-1,4-phthalazinedione, 5-nitrophthalhydrazide, 3-Nitrophthalic hydrazine, Oprea1_294149