cas: 40635-11-8 — see every product listed under this CAS number, including other names
6,7-Dichloroquinoline, ≥98%, ≥98% (CAS 40635-11-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N1V-1g |
| cas | 40635-11-8 |
| size | 1g |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 568.40 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
6,7-dichloroquinoline (CAS 40635-11-8) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 6,7-dichloroquinoline. InChIKey: VOEBOQZMOGFLTJ-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 6,7-dichloroquinoline |
| InChIKey | VOEBOQZMOGFLTJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2N=C1)Cl)Cl |
Computed by PubChem (NCBI)