cas: 703-66-2 — see every product listed under this CAS number, including other names
6,8-Dichloroquinoline, 98%, 98% (CAS 703-66-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116JJW-100mg |
| cas | 703-66-2 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 309.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6,8-dichloroquinoline (CAS 703-66-2) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 6,8-dichloroquinoline. InChIKey: LAHRXLPRNCGSAB-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 6,8-dichloroquinoline |
| InChIKey | LAHRXLPRNCGSAB-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)Cl)Cl |
Computed by PubChem (NCBI)