cas: 862695-75-8 — see every product listed under this CAS number, including other names
6-Chloro-2-cyclopropylnicotinic acid, 95+% (CAS 862695-75-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A280284-5g |
| cas | 862695-75-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 32144.77 Pln | |
| AmBeed | 1g | 9848.02 Pln | |
| AmBeed | 250mg | 3832.78 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
6-chloro-2-cyclopropylpyridine-3-carboxylic acid (CAS 862695-75-8) is a chemical compound with the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. IUPAC name: 6-chloro-2-cyclopropylpyridine-3-carboxylic acid. InChIKey: FZPUPGGRIJXKTC-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 6-chloro-2-cyclopropylpyridine-3-carboxylic acid |
| InChIKey | FZPUPGGRIJXKTC-UHFFFAOYSA-N |
| SMILES | C1CC1C2=C(C=CC(=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)