6-Chlorobenzo[d]isoxazole-3-carboxylic acid, 98%
cas: 28691-49-8 — see every product listed under this CAS number, including other names
6-Chlorobenzo[d]isoxazole-3-carboxylic acid, 98% (CAS 28691-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch113W56-100mg |
| cas | 28691-49-8 |
| size | 100mg |
| availability | 5.2g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 501.20 Pln | |
| Chemat | 5g | 2152.40 Pln | |
| Fluorochem | 250mg | 211.40 Pln | |
| Fluorochem | 1g | 638.33 Pln | |
| Fluorochem | 5g | 2866.72 Pln | |
| Fluorochem | 10g | 5610.54 Pln | |
| Fluorochem | 25g | 13118.32 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-chloro-1,2-benzoxazole-3-carboxylic acid (CAS 28691-49-8) is a chemical compound with the molecular formula C8H4ClNO3 and a molecular weight of 197.57 g/mol. IUPAC name: 6-chloro-1,2-benzoxazole-3-carboxylic acid. InChIKey: NWWICAZKQSVOGE-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO3 |
|---|---|
| Molecular weight | 197.57 g/mol |
| IUPAC name | 6-chloro-1,2-benzoxazole-3-carboxylic acid |
| InChIKey | NWWICAZKQSVOGE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)ON=C2C(=O)O |
Computed by PubChem (NCBI)