7,8-Dichloroisoquinoline, 95%, 95%
cas: 61563-36-8 — see every product listed under this CAS number, including other names
7,8-Dichloroisoquinoline, 95%, 95% (CAS 61563-36-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EBN6-100mg |
| cas | 61563-36-8 |
| size | 100mg |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 890.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7,8-dichloroisoquinoline (CAS 61563-36-8) is a chemical compound with the molecular formula C9H5Cl2N and a molecular weight of 198.05 g/mol. IUPAC name: 7,8-dichloroisoquinoline. InChIKey: MYYHZQIWSAUHJB-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2N |
|---|---|
| Molecular weight | 198.05 g/mol |
| IUPAC name | 7,8-dichloroisoquinoline |
| InChIKey | MYYHZQIWSAUHJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN=C2)Cl)Cl |
Computed by PubChem (NCBI)