cas: 4965-36-0 — see every product listed under this CAS number, including other names
7-bromoquinoline, 98%, 98% (CAS 4965-36-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NDZ-1g |
| cas | 4965-36-0 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 242.00 Pln | |
| Chemat | 100g | 789.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-bromoquinoline (CAS 4965-36-0) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 7-bromoquinoline. InChIKey: XYBSZCUHOLWQQU-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 7-bromoquinoline |
| InChIKey | XYBSZCUHOLWQQU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)Br)N=C1 |
Computed by PubChem (NCBI)