cas: 16567-18-3 — see every product listed under this CAS number, including other names
8-Bromoquinoline, 98%, 98% (CAS 16567-18-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100g, 500g, 1kg, 5kg, 10kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112WAU-1g |
| cas | 16567-18-3 |
| size | 1g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 100g | 338.00 Pln | |
| Chemat | 500g | 1512.00 Pln | |
| Chemat | 1kg | 2315.60 Pln | |
| Chemat | 5kg | 11539.20 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
8-bromoquinoline (CAS 16567-18-3) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 8-bromoquinoline. InChIKey: PIWNKSHCLTZKSZ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 8-bromoquinoline |
| InChIKey | PIWNKSHCLTZKSZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)N=CC=C2 |
Computed by PubChem (NCBI)