CAS 29021-67-8 appears in our catalog under these names: 8–Hydroxy–2–methylquinoline–5–sulfonic acid, 8-Hydroxy-2-methylquinoline-5-sulfonic acid, 98%, 98%, 8-Hydroxy-2-methylquinoline-5-sulfonic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
8-hydroxy-2-methylquinoline-5-sulfonic acid (CAS 29021-67-8) is a chemical compound with the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. IUPAC name: 8-hydroxy-2-methylquinoline-5-sulfonic acid. InChIKey: RDYCCKHYFOQHOD-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4S |
|---|---|
| Molecular weight | 239.25 g/mol |
| IUPAC name | 8-hydroxy-2-methylquinoline-5-sulfonic acid |
| InChIKey | RDYCCKHYFOQHOD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC(=C2C=C1)S(=O)(=O)O)O |
Computed by PubChem (NCBI)