cas: 3744-87-4 — see every product listed under this CAS number, including other names
Boc-DL-Ala-OH 95% (CAS 3744-87-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A160646-10g |
| cas | 3744-87-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 225.75 Pln | |
| Ambeed | 500g | 654.06 Pln | |
| Ambeed | 1000g | 1238.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A160646 |
2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 3744-87-4) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QVHJQCGUWFKTSE-UHFFFAOYSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QVHJQCGUWFKTSE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)