cas: 3744-87-4 — see every product listed under this CAS number, including other names
tert-Butoxycarbonyl-DL-alanine, 98.0% (CAS 3744-87-4) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-Y0920-100 g |
| cas | 3744-87-4 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 315.05 Pln | |
| MedChemExpress | 500 g | 853.75 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.0% |
2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 3744-87-4) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QVHJQCGUWFKTSE-UHFFFAOYSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QVHJQCGUWFKTSE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)