L-Carnitine HCl 97%
cas: 6645-46-1 — see every product listed under this CAS number, including other names
L-Carnitine HCl 97% (CAS 6645-46-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142902-25g |
| cas | 6645-46-1 |
| size | 25g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 264.69 Pln | |
| Ambeed | 500g | 565.06 Pln | |
| Ambeed | 1000g | 1054.56 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142902 |
[(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride (CAS 6645-46-1) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: [(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride. InChIKey: JXXCENBLGFBQJM-FYZOBXCZSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride |
| InChIKey | JXXCENBLGFBQJM-FYZOBXCZSA-N |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)O.[Cl-] |
Computed by PubChem (NCBI)