cas: 6645-46-1 — see every product listed under this CAS number, including other names
L-Carnitine hydrochloride, 98.00% (CAS 6645-46-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1kg, 250g, 25g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM45800M-100g |
| cas | 6645-46-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 296.46 Pln | |
| Chemat | 1kg | 1136.18 Pln | |
| Chemat | 250g | 464.40 Pln | |
| Chemat | 25g | 171.66 Pln | |
| Chemat | 500g | 716.34 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
[(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride (CAS 6645-46-1) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: [(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride. InChIKey: JXXCENBLGFBQJM-FYZOBXCZSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-hydroxypropyl]-trimethylazanium chloride |
| InChIKey | JXXCENBLGFBQJM-FYZOBXCZSA-N |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)O)O.[Cl-] |
Computed by PubChem (NCBI)