cas: 935534-49-9 — see every product listed under this CAS number, including other names
Methyl 3-bromo-2,4-difluorobenzoate, ≥95%, ≥95% (CAS 935534-49-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHNY-1g |
| cas | 935534-49-9 |
| size | 1g |
| availability | 36g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2459.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-2,4-difluorobenzoate (CAS 935534-49-9) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 3-bromo-2,4-difluorobenzoate. InChIKey: SKRVCQHKXUICKH-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 3-bromo-2,4-difluorobenzoate |
| InChIKey | SKRVCQHKXUICKH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)Br)F |
Computed by PubChem (NCBI)