cas: 1524902-93-9 — see every product listed under this CAS number, including other names
Methyl 3-bromo-2,5-difluorobenzoate 98% (CAS 1524902-93-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A670618-100mg |
| cas | 1524902-93-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 392.62 Pln | |
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1594.12 Pln | |
| Ambeed | 5g | 4675.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A670618 |
Methyl 3-bromo-2,5-difluorobenzoate (CAS 1524902-93-9) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 3-bromo-2,5-difluorobenzoate. InChIKey: LDPLGGXRWAKNHS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 3-bromo-2,5-difluorobenzoate |
| InChIKey | LDPLGGXRWAKNHS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)F)Br)F |
Computed by PubChem (NCBI)