cas: 1244642-70-3 — see every product listed under this CAS number, including other names
Methyl 3-bromo-4,5-difluorobenzoate, 98%, 98% (CAS 1244642-70-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111M2T-1g |
| cas | 1244642-70-3 |
| size | 1g |
| availability | 80g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 357.20 Pln | |
| Chemat | 10g | 563.60 Pln | |
| Chemat | 25g | 1091.60 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-bromo-4,5-difluorobenzoate (CAS 1244642-70-3) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 3-bromo-4,5-difluorobenzoate. InChIKey: KDMXMSNYYICQEL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 3-bromo-4,5-difluorobenzoate |
| InChIKey | KDMXMSNYYICQEL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)F)F |
Computed by PubChem (NCBI)