cas: 2645-07-0 — see every product listed under this CAS number, including other names
N-(4-Nitrobenzoyl)glycine, 99.74% (CAS 2645-07-0) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W028991-100 g |
| cas | 2645-07-0 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 654.06 Pln | |
| MedChemExpress | 25 g | 356.84 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.74% |
2-[(4-nitrobenzoyl)amino]acetic acid (CAS 2645-07-0) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: 2-[(4-nitrobenzoyl)amino]acetic acid. InChIKey: XCMUCRMMVDSVEL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 2-[(4-nitrobenzoyl)amino]acetic acid |
| InChIKey | XCMUCRMMVDSVEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)