cas: 2645-07-0 — see every product listed under this CAS number, including other names
N-(4-nitrobenzoyl)glycine, 98% (CAS 2645-07-0) is a chemical reagent available from Chemat. Available pack sizes: 2.5g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F375131-2.5G |
| cas | 2645-07-0 |
| size | 2.5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 2.5g | 128.10 Pln | |
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 25g | 232.23 Pln | |
| Fluorochem | 100g | 529.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[(4-nitrobenzoyl)amino]acetic acid (CAS 2645-07-0) is a chemical compound with the molecular formula C9H8N2O5 and a molecular weight of 224.17 g/mol. IUPAC name: 2-[(4-nitrobenzoyl)amino]acetic acid. InChIKey: XCMUCRMMVDSVEL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O5 |
|---|---|
| Molecular weight | 224.17 g/mol |
| IUPAC name | 2-[(4-nitrobenzoyl)amino]acetic acid |
| InChIKey | XCMUCRMMVDSVEL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)